C34H20O8S2 — CID 170899498
4-[2,5,6-tris(4-carboxyphenyl)thieno[3,2-b]thiophen-3-yl]benzoic acid (PubChem CID 170899498) has the molecular formula C34H20O8S2 and a molecular weight of 620.66 g/mol. Its IUPAC name is 4-[2,5,6-tris(4-carboxyphenyl)thieno[3,2-b]thiophen-3-yl]benzoic acid.
| Compound Name | 4-[2,5,6-tris(4-carboxyphenyl)thieno[3,2-b]thiophen-3-yl]benzoic acid |
|---|---|
| PubChem CID | 170899498 |
| Molecular Formula | C34H20O8S2 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | 4-[2,5,6-tris(4-carboxyphenyl)thieno[3,2-b]thiophen-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2sc3c(-c4ccc(C(=O)O)cc4)c(-c4ccc(C(=O)O)cc4)sc3c2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H20O8S2/c35-31(36)21-9-1-17(2-10-21)25-27(19-5-13-23(14-6-19)33(39)40)43-30-26(18-3-11-22(12-4-18)32(37)38)28(44-29(25)30)20-7-15-24(16-8-20)34(41)42/h1-16H,(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | JULQBVQOMFHLAJ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |