C34H20Br2O8 — CID 101494786
4-[2,5-dibromo-3,4,6-tris(4-carboxyphenyl)phenyl]benzoic acid (PubChem CID 101494786) has the molecular formula C34H20Br2O8 and a molecular weight of 716.33 g/mol. Its IUPAC name is 4-[2,5-dibromo-3,4,6-tris(4-carboxyphenyl)phenyl]benzoic acid.
| Compound Name | 4-[2,5-dibromo-3,4,6-tris(4-carboxyphenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 101494786 |
| Molecular Formula | C34H20Br2O8 |
| Molecular Weight | 716.33 g/mol |
| Exact Mass | 713.95 |
| IUPAC Name | 4-[2,5-dibromo-3,4,6-tris(4-carboxyphenyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(Br)c(-c3ccc(C(=O)O)cc3)c(-c3ccc(C(=O)O)cc3)c(Br)c2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H20Br2O8/c35-29-25(17-1-9-21(10-2-17)31(37)38)26(18-3-11-22(12-4-18)32(39)40)30(36)28(20-7-15-24(16-8-20)34(43)44)27(29)19-5-13-23(14-6-19)33(41)42/h1-16H,(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | QSORRHRIOAUAMT-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.33 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |