4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid

C16H10N2O4S — CID 13351514

IUPAC4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid
SMILESO=C(O)c1ccc(-c2nnc(-c3ccc(C(=O)O)cc3)s2)cc1
InChIInChI=1S/C16H10N2O4S/c19-15(20)11-5-1-9(2-6-11)13-17-18-14(23-13)10-3-7-12(8-4-10)16(21)22/h1-8H,(H,19,20)(H,21,22)
InChIKeyVAIORAMKWJSOCD-UHFFFAOYSA-N
MW326.33 g/mol
LogP3.27
Rot. Bonds4

About 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid

4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid (PubChem CID 13351514) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid.

Molecular Properties

Compound Name4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid
PubChem CID13351514
Molecular FormulaC16H10N2O4S
Molecular Weight326.33 g/mol
Exact Mass326.04
IUPAC Name4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid
SMILESO=C(O)c1ccc(-c2nnc(-c3ccc(C(=O)O)cc3)s2)cc1
InChIInChI=1S/C16H10N2O4S/c19-15(20)11-5-1-9(2-6-11)13-17-18-14(23-13)10-3-7-12(8-4-10)16(21)22/h1-8H,(H,19,20)(H,21,22)
InChIKeyVAIORAMKWJSOCD-UHFFFAOYSA-N
XLogP3.27
TPSA100.38 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.33
LogP ≤ 53.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid?
The IUPAC name of 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid (CID 13351514) is 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid?
The canonical SMILES for 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid is O=C(O)c1ccc(-c2nnc(-c3ccc(C(=O)O)cc3)s2)cc1.
What is the InChIKey of 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid?
The InChIKey is VAIORAMKWJSOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4S/c19-15(20)11-5-1-9(2-6-11)13-17-18-14(23-13)10-3-7-12(8-4-10)16(21)22/h1-8H,(H,19,20)(H,21,22).
What are the key properties of 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid?
4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid has a molecular weight of 326.33 g/mol, XLogP of 3.27, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-carboxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid is sourced from PubChem (CID 13351514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).