C26H18N2S — CID 122206222
2,5-bis(4-phenylphenyl)-1,3,4-thiadiazole (PubChem CID 122206222) has the molecular formula C26H18N2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2,5-bis(4-phenylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2,5-bis(4-phenylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 122206222 |
| Molecular Formula | C26H18N2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2,5-bis(4-phenylphenyl)-1,3,4-thiadiazole |
| SMILES | c1ccc(-c2ccc(-c3nnc(-c4ccc(-c5ccccc5)cc4)s3)cc2)cc1 |
| InChI | InChI=1S/C26H18N2S/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-27-28-26(29-25)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H |
| InChIKey | QYMPPEGKDHHXOQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |