C22H14N2O2S — CID 122206225
2,5-bis[4-(furan-3-yl)phenyl]-1,3,4-thiadiazole (PubChem CID 122206225) has the molecular formula C22H14N2O2S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2,5-bis[4-(furan-3-yl)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2,5-bis[4-(furan-3-yl)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 122206225 |
| Molecular Formula | C22H14N2O2S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2,5-bis[4-(furan-3-yl)phenyl]-1,3,4-thiadiazole |
| SMILES | c1cc(-c2ccc(-c3nnc(-c4ccc(-c5ccoc5)cc4)s3)cc2)co1 |
| InChI | InChI=1S/C22H14N2O2S/c1-5-17(6-2-15(1)19-9-11-25-13-19)21-23-24-22(27-21)18-7-3-16(4-8-18)20-10-12-26-14-20/h1-14H |
| InChIKey | MLBIPFHZROELEE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |