C20H28N2S — CID 91287482
2,5-diphenyl-1,3,4-thiadiazole;ethane (PubChem CID 91287482) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is 2,5-diphenyl-1,3,4-thiadiazole;ethane.
| Compound Name | 2,5-diphenyl-1,3,4-thiadiazole;ethane |
|---|---|
| PubChem CID | 91287482 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2,5-diphenyl-1,3,4-thiadiazole;ethane |
| SMILES | CC.CC.CC.c1ccc(-c2nnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C14H10N2S.3C2H6/c1-3-7-11(8-4-1)13-15-16-14(17-13)12-9-5-2-6-10-12;3*1-2/h1-10H;3*1-2H3 |
| InChIKey | ANTLLZAYWYZBGZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |