C9H6N4S — CID 24942095
2-(diazomethyl)-5-phenyl-1,3,4-thiadiazole (PubChem CID 24942095) has the molecular formula C9H6N4S and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-(diazomethyl)-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-(diazomethyl)-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 24942095 |
| Molecular Formula | C9H6N4S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2-(diazomethyl)-5-phenyl-1,3,4-thiadiazole |
| SMILES | [N-]=[N+]=Cc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H6N4S/c10-11-6-8-12-13-9(14-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | GIMVHAPZQKXPGZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|