About bis(diazomethylbenzene);hydrate
bis(diazomethylbenzene);hydrate (PubChem CID 21319266) has the molecular formula C14H14N4O
and a molecular weight of 254.29 g/mol. Its IUPAC name is bis(diazomethylbenzene);hydrate.
Molecular Properties
| Compound Name | bis(diazomethylbenzene);hydrate |
| PubChem CID | 21319266 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | bis(diazomethylbenzene);hydrate |
| SMILES | O.[N-]=[N+]=Cc1ccccc1.[N-]=[N+]=Cc1ccccc1 |
| InChI | InChI=1S/2C7H6N2.H2O/c2*8-9-6-7-4-2-1-3-5-7;/h2*1-6H;1H2 |
| InChIKey | HBLDCVLDKVIQES-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze bis(diazomethylbenzene);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diazomethylbenzene);hydrate?
The IUPAC name of bis(diazomethylbenzene);hydrate (CID 21319266) is bis(diazomethylbenzene);hydrate.
What is the SMILES notation for bis(diazomethylbenzene);hydrate?
The canonical SMILES for bis(diazomethylbenzene);hydrate is O.[N-]=[N+]=Cc1ccccc1.[N-]=[N+]=Cc1ccccc1.
What is the InChIKey of bis(diazomethylbenzene);hydrate?
The InChIKey is HBLDCVLDKVIQES-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6N2.H2O/c2*8-9-6-7-4-2-1-3-5-7;/h2*1-6H;1H2.
What are the key properties of bis(diazomethylbenzene);hydrate?
bis(diazomethylbenzene);hydrate has a molecular weight of 254.29 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diazomethylbenzene);hydrate is sourced from PubChem (CID 21319266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).