About dibenzylideneiron
dibenzylideneiron (PubChem CID 175416558) has the molecular formula C14H12Fe
and a molecular weight of 236.10 g/mol. Its IUPAC name is dibenzylideneiron.
Molecular Properties
| Compound Name | dibenzylideneiron |
| PubChem CID | 175416558 |
| Molecular Formula | C14H12Fe |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | dibenzylideneiron |
| SMILES | C(=[Fe]=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C7H6.Fe/c2*1-7-5-3-2-4-6-7;/h2*1-6H; |
| InChIKey | PSMHEVIURRVFFE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibenzylideneiron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzylideneiron?
The IUPAC name of dibenzylideneiron (CID 175416558) is dibenzylideneiron.
What is the SMILES notation for dibenzylideneiron?
The canonical SMILES for dibenzylideneiron is C(=[Fe]=Cc1ccccc1)c1ccccc1.
What is the InChIKey of dibenzylideneiron?
The InChIKey is PSMHEVIURRVFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6.Fe/c2*1-7-5-3-2-4-6-7;/h2*1-6H;.
What are the key properties of dibenzylideneiron?
dibenzylideneiron has a molecular weight of 236.10 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzylideneiron is sourced from PubChem (CID 175416558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).