C18H20N2S — CID 91493017
2-(2,5-dimethylphenyl)-5-phenyl-1,3,4-thiadiazole;ethane (PubChem CID 91493017) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5-phenyl-1,3,4-thiadiazole;ethane.
| Compound Name | 2-(2,5-dimethylphenyl)-5-phenyl-1,3,4-thiadiazole;ethane |
|---|---|
| PubChem CID | 91493017 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5-phenyl-1,3,4-thiadiazole;ethane |
| SMILES | CC.Cc1ccc(C)c(-c2nnc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C16H14N2S.C2H6/c1-11-8-9-12(2)14(10-11)16-18-17-15(19-16)13-6-4-3-5-7-13;1-2/h3-10H,1-2H3;1-2H3 |
| InChIKey | IIUMVISSFURSQS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |