C27H22N2S — CID 138712488
2-[6-(2,5-dimethylphenyl)-4-phenyl-1,3-benzothiazol-2-yl]aniline (PubChem CID 138712488) has the molecular formula C27H22N2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-[6-(2,5-dimethylphenyl)-4-phenyl-1,3-benzothiazol-2-yl]aniline.
| Compound Name | 2-[6-(2,5-dimethylphenyl)-4-phenyl-1,3-benzothiazol-2-yl]aniline |
|---|---|
| PubChem CID | 138712488 |
| Molecular Formula | C27H22N2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[6-(2,5-dimethylphenyl)-4-phenyl-1,3-benzothiazol-2-yl]aniline |
| SMILES | Cc1ccc(C)c(-c2cc(-c3ccccc3)c3nc(-c4ccccc4N)sc3c2)c1 |
| InChI | InChI=1S/C27H22N2S/c1-17-12-13-18(2)22(14-17)20-15-23(19-8-4-3-5-9-19)26-25(16-20)30-27(29-26)21-10-6-7-11-24(21)28/h3-16H,28H2,1-2H3 |
| InChIKey | UAOJSCXNOLQNEM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|