C24H24N2OS — CID 129137930
2-[[4-methyl-2-(2-methyl-3-phenylphenyl)-1,3-benzothiazol-6-yl]methylamino]ethanol (PubChem CID 129137930) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[[4-methyl-2-(2-methyl-3-phenylphenyl)-1,3-benzothiazol-6-yl]methylamino]ethanol.
| Compound Name | 2-[[4-methyl-2-(2-methyl-3-phenylphenyl)-1,3-benzothiazol-6-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 129137930 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[[4-methyl-2-(2-methyl-3-phenylphenyl)-1,3-benzothiazol-6-yl]methylamino]ethanol |
| SMILES | Cc1c(-c2ccccc2)cccc1-c1nc2c(C)cc(CNCCO)cc2s1 |
| InChI | InChI=1S/C24H24N2OS/c1-16-13-18(15-25-11-12-27)14-22-23(16)26-24(28-22)21-10-6-9-20(17(21)2)19-7-4-3-5-8-19/h3-10,13-14,25,27H,11-12,15H2,1-2H3 |
| InChIKey | VFOMDPPPRGYNHX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|