C22H23N5O — CID 146339448
2-[[8-(2-methyl-3-phenylanilino)imidazo[1,5-a]pyrimidin-3-yl]methylamino]ethanol (PubChem CID 146339448) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[[8-(2-methyl-3-phenylanilino)imidazo[1,5-a]pyrimidin-3-yl]methylamino]ethanol.
| Compound Name | 2-[[8-(2-methyl-3-phenylanilino)imidazo[1,5-a]pyrimidin-3-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 146339448 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[[8-(2-methyl-3-phenylanilino)imidazo[1,5-a]pyrimidin-3-yl]methylamino]ethanol |
| SMILES | Cc1c(Nc2ncn3cc(CNCCO)cnc23)cccc1-c1ccccc1 |
| InChI | InChI=1S/C22H23N5O/c1-16-19(18-6-3-2-4-7-18)8-5-9-20(16)26-21-22-24-13-17(12-23-10-11-28)14-27(22)15-25-21/h2-9,13-15,23,26,28H,10-12H2,1H3 |
| InChIKey | LROYUZCLWJWARK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|