C30H36N4O3S — CID 146339376
2-[[3-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]anilino]thieno[3,2-b]pyridin-6-yl]methylamino]ethanol (PubChem CID 146339376) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is 2-[[3-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]anilino]thieno[3,2-b]pyridin-6-yl]methylamino]ethanol.
| Compound Name | 2-[[3-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]anilino]thieno[3,2-b]pyridin-6-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 146339376 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 2-[[3-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]anilino]thieno[3,2-b]pyridin-6-yl]methylamino]ethanol |
| SMILES | Cc1c(Nc2csc3cc(CNCCO)cnc23)cccc1-c1cccc(OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C30H36N4O3S/c1-22-26(24-5-2-6-25(18-24)37-14-4-10-34-11-15-36-16-12-34)7-3-8-27(22)33-28-21-38-29-17-23(19-31-9-13-35)20-32-30(28)29/h2-3,5-8,17-18,20-21,31,33,35H,4,9-16,19H2,1H3 |
| InChIKey | GDEPMJNMRCOHSI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|