C31H40N2O6 — CID 121460134
2-[[2,6-dimethoxy-4-[[2-methyl-3-[3-(2-morpholin-4-ylethoxy)phenyl]phenyl]methoxy]phenyl]methylamino]ethanol (PubChem CID 121460134) has the molecular formula C31H40N2O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[[2,6-dimethoxy-4-[[2-methyl-3-[3-(2-morpholin-4-ylethoxy)phenyl]phenyl]methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[2,6-dimethoxy-4-[[2-methyl-3-[3-(2-morpholin-4-ylethoxy)phenyl]phenyl]methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 121460134 |
| Molecular Formula | C31H40N2O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 2-[[2,6-dimethoxy-4-[[2-methyl-3-[3-(2-morpholin-4-ylethoxy)phenyl]phenyl]methoxy]phenyl]methylamino]ethanol |
| SMILES | COc1cc(OCc2cccc(-c3cccc(OCCN4CCOCC4)c3)c2C)cc(OC)c1CNCCO |
| InChI | InChI=1S/C31H40N2O6/c1-23-25(22-39-27-19-30(35-2)29(21-32-10-14-34)31(20-27)36-3)7-5-9-28(23)24-6-4-8-26(18-24)38-17-13-33-11-15-37-16-12-33/h4-9,18-20,32,34H,10-17,21-22H2,1-3H3 |
| InChIKey | BEQATRHVWPPUPJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|