C29H33N3O4 — CID 146311874
[6-methoxy-2-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]-1,3-benzoxazol-5-yl]methanamine (PubChem CID 146311874) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is [6-methoxy-2-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]-1,3-benzoxazol-5-yl]methanamine.
| Compound Name | [6-methoxy-2-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]-1,3-benzoxazol-5-yl]methanamine |
|---|---|
| PubChem CID | 146311874 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | [6-methoxy-2-[2-methyl-3-[3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]-1,3-benzoxazol-5-yl]methanamine |
| SMILES | COc1cc2oc(-c3cccc(-c4cccc(OCCCN5CCOCC5)c4)c3C)nc2cc1CN |
| InChI | InChI=1S/C29H33N3O4/c1-20-24(21-6-3-7-23(16-21)35-13-5-10-32-11-14-34-15-12-32)8-4-9-25(20)29-31-26-17-22(19-30)27(33-2)18-28(26)36-29/h3-4,6-9,16-18H,5,10-15,19,30H2,1-2H3 |
| InChIKey | MAXIOCNGSFNIQY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|