C27H25F3N2O4 — CID 72946732
2-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazole (PubChem CID 72946732) has the molecular formula C27H25F3N2O4 and a molecular weight of 498.50 g/mol. Its IUPAC name is 2-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazole.
| Compound Name | 2-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazole |
|---|---|
| PubChem CID | 72946732 |
| Molecular Formula | C27H25F3N2O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazole |
| SMILES | FC(F)(F)c1cccc(Oc2ccc3nc(-c4ccc(OCCCN5CCOCC5)cc4)oc3c2)c1 |
| InChI | InChI=1S/C27H25F3N2O4/c28-27(29,30)20-3-1-4-22(17-20)35-23-9-10-24-25(18-23)36-26(31-24)19-5-7-21(8-6-19)34-14-2-11-32-12-15-33-16-13-32/h1,3-10,17-18H,2,11-16H2 |
| InChIKey | KBMCZMJFJKGANM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|