C25H31N5O4 — CID 171827599
5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 171827599) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171827599 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(O)c(C)c1-n1nc(-c2cccc(OCCCN3CCOCC3)c2)c(C(N)=O)c1N |
| InChI | InChI=1S/C25H31N5O4/c1-16-7-8-20(31)17(2)23(16)30-24(26)21(25(27)32)22(28-30)18-5-3-6-19(15-18)34-12-4-9-29-10-13-33-14-11-29/h3,5-8,15,31H,4,9-14,26H2,1-2H3,(H2,27,32) |
| InChIKey | IVJFVHVFDKRXSF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|