C22H30FN3O2 — CID 3746110
4-(3-fluorophenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-propylpyrrole-3-carboxamide (PubChem CID 3746110) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-propylpyrrole-3-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-propylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3746110 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 4-(3-fluorophenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-propylpyrrole-3-carboxamide |
| SMILES | CCCc1c(-c2cccc(F)c2)c(C(N)=O)c(C)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C22H30FN3O2/c1-3-6-19-21(17-7-4-8-18(23)15-17)20(22(24)27)16(2)26(19)10-5-9-25-11-13-28-14-12-25/h4,7-8,15H,3,5-6,9-14H2,1-2H3,(H2,24,27) |
| InChIKey | ATRRIJFGLZCICK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |