C25H35N3O4 — CID 3854944
methyl 4-[2-butyl-4-carbamoyl-5-methyl-1-(3-morpholin-4-ylpropyl)pyrrol-3-yl]benzoate (PubChem CID 3854944) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl 4-[2-butyl-4-carbamoyl-5-methyl-1-(3-morpholin-4-ylpropyl)pyrrol-3-yl]benzoate.
| Compound Name | methyl 4-[2-butyl-4-carbamoyl-5-methyl-1-(3-morpholin-4-ylpropyl)pyrrol-3-yl]benzoate |
|---|---|
| PubChem CID | 3854944 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | methyl 4-[2-butyl-4-carbamoyl-5-methyl-1-(3-morpholin-4-ylpropyl)pyrrol-3-yl]benzoate |
| SMILES | CCCCc1c(-c2ccc(C(=O)OC)cc2)c(C(N)=O)c(C)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C25H35N3O4/c1-4-5-7-21-23(19-8-10-20(11-9-19)25(30)31-3)22(24(26)29)18(2)28(21)13-6-12-27-14-16-32-17-15-27/h8-11H,4-7,12-17H2,1-3H3,(H2,26,29) |
| InChIKey | WEBNGYXRFXFGRV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |