C24H35N3O3 — CID 3480119
4-(3-hydroxyphenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-pentylpyrrole-3-carboxamide (PubChem CID 3480119) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-pentylpyrrole-3-carboxamide.
| Compound Name | 4-(3-hydroxyphenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3480119 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 4-(3-hydroxyphenyl)-2-methyl-1-(3-morpholin-4-ylpropyl)-5-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2cccc(O)c2)c(C(N)=O)c(C)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C24H35N3O3/c1-3-4-5-10-21-23(19-8-6-9-20(28)17-19)22(24(25)29)18(2)27(21)12-7-11-26-13-15-30-16-14-26/h6,8-9,17,28H,3-5,7,10-16H2,1-2H3,(H2,25,29) |
| InChIKey | PYHBXIARPFCWLV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|