C25H30N2O3 — CID 3737651
4-(3-hydroxyphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentylpyrrole-3-carboxamide (PubChem CID 3737651) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentylpyrrole-3-carboxamide.
| Compound Name | 4-(3-hydroxyphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3737651 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-(3-hydroxyphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2cccc(O)c2)c(C(N)=O)c(C)n1Cc1ccccc1OC |
| InChI | InChI=1S/C25H30N2O3/c1-4-5-6-13-21-24(18-11-9-12-20(28)15-18)23(25(26)29)17(2)27(21)16-19-10-7-8-14-22(19)30-3/h7-12,14-15,28H,4-6,13,16H2,1-3H3,(H2,26,29) |
| InChIKey | FIUSWBHTBGICFW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|