C26H29F3N2O2 — CID 3685628
1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentyl-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 3685628) has the molecular formula C26H29F3N2O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentyl-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentyl-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3685628 |
| Molecular Formula | C26H29F3N2O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-2-methyl-5-pentyl-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccc(C(F)(F)F)cc2)c(C(N)=O)c(C)n1Cc1ccccc1OC |
| InChI | InChI=1S/C26H29F3N2O2/c1-4-5-6-10-21-24(18-12-14-20(15-13-18)26(27,28)29)23(25(30)32)17(2)31(21)16-19-9-7-8-11-22(19)33-3/h7-9,11-15H,4-6,10,16H2,1-3H3,(H2,30,32) |
| InChIKey | KBQJEZJQFIZSEF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|