C30H32N2O — CID 3690557
1-benzyl-2-methyl-5-pentyl-4-(4-phenylphenyl)pyrrole-3-carboxamide (PubChem CID 3690557) has the molecular formula C30H32N2O and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-benzyl-2-methyl-5-pentyl-4-(4-phenylphenyl)pyrrole-3-carboxamide.
| Compound Name | 1-benzyl-2-methyl-5-pentyl-4-(4-phenylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3690557 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-benzyl-2-methyl-5-pentyl-4-(4-phenylphenyl)pyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccc(-c3ccccc3)cc2)c(C(N)=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H32N2O/c1-3-4-7-16-27-29(26-19-17-25(18-20-26)24-14-10-6-11-15-24)28(30(31)33)22(2)32(27)21-23-12-8-5-9-13-23/h5-6,8-15,17-20H,3-4,7,16,21H2,1-2H3,(H2,31,33) |
| InChIKey | QANBITURLVKTEA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|