C23H24BrClN2O — CID 3287721
4-(4-bromophenyl)-5-butyl-1-[(3-chlorophenyl)methyl]-2-methylpyrrole-3-carboxamide (PubChem CID 3287721) has the molecular formula C23H24BrClN2O and a molecular weight of 459.82 g/mol. Its IUPAC name is 4-(4-bromophenyl)-5-butyl-1-[(3-chlorophenyl)methyl]-2-methylpyrrole-3-carboxamide.
| Compound Name | 4-(4-bromophenyl)-5-butyl-1-[(3-chlorophenyl)methyl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3287721 |
| Molecular Formula | C23H24BrClN2O |
| Molecular Weight | 459.82 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4-(4-bromophenyl)-5-butyl-1-[(3-chlorophenyl)methyl]-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccc(Br)cc2)c(C(N)=O)c(C)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24BrClN2O/c1-3-4-8-20-22(17-9-11-18(24)12-10-17)21(23(26)28)15(2)27(20)14-16-6-5-7-19(25)13-16/h5-7,9-13H,3-4,8,14H2,1-2H3,(H2,26,28) |
| InChIKey | VVHLQRCRLFTFQR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.82 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |