C23H26ClN3O — CID 3415171
1-[(3-chlorophenyl)methyl]-2-methyl-5-pentyl-4-pyridin-3-ylpyrrole-3-carboxamide (PubChem CID 3415171) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-methyl-5-pentyl-4-pyridin-3-ylpyrrole-3-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-methyl-5-pentyl-4-pyridin-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3415171 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-methyl-5-pentyl-4-pyridin-3-ylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2cccnc2)c(C(N)=O)c(C)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H26ClN3O/c1-3-4-5-11-20-22(18-9-7-12-26-14-18)21(23(25)28)16(2)27(20)15-17-8-6-10-19(24)13-17/h6-10,12-14H,3-5,11,15H2,1-2H3,(H2,25,28) |
| InChIKey | HXLWKMAUSFJEDF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|