C22H24F2N2OS — CID 3466776
1-[(3,4-difluorophenyl)methyl]-2-methyl-5-pentyl-4-thiophen-3-ylpyrrole-3-carboxamide (PubChem CID 3466776) has the molecular formula C22H24F2N2OS and a molecular weight of 402.51 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-2-methyl-5-pentyl-4-thiophen-3-ylpyrrole-3-carboxamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-2-methyl-5-pentyl-4-thiophen-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3466776 |
| Molecular Formula | C22H24F2N2OS |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-2-methyl-5-pentyl-4-thiophen-3-ylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccsc2)c(C(N)=O)c(C)n1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H24F2N2OS/c1-3-4-5-6-19-21(16-9-10-28-13-16)20(22(25)27)14(2)26(19)12-15-7-8-17(23)18(24)11-15/h7-11,13H,3-6,12H2,1-2H3,(H2,25,27) |
| InChIKey | KXNAGIBUURAYMT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|