C26H28F2N2O3 — CID 3466773
1-[(3,4-difluorophenyl)methyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-5-pentylpyrrole-3-carboxamide (PubChem CID 3466773) has the molecular formula C26H28F2N2O3 and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-5-pentylpyrrole-3-carboxamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-5-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3466773 |
| Molecular Formula | C26H28F2N2O3 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-5-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccc3c(c2)OCCO3)c(C(N)=O)c(C)n1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H28F2N2O3/c1-3-4-5-6-21-25(18-8-10-22-23(14-18)33-12-11-32-22)24(26(29)31)16(2)30(21)15-17-7-9-19(27)20(28)13-17/h7-10,13-14H,3-6,11-12,15H2,1-2H3,(H2,29,31) |
| InChIKey | QIVHEWGYQRJUKO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|