C21H31N3OS — CID 3483517
5-butyl-2-methyl-1-(2-piperidin-1-ylethyl)-4-thiophen-3-ylpyrrole-3-carboxamide (PubChem CID 3483517) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 5-butyl-2-methyl-1-(2-piperidin-1-ylethyl)-4-thiophen-3-ylpyrrole-3-carboxamide.
| Compound Name | 5-butyl-2-methyl-1-(2-piperidin-1-ylethyl)-4-thiophen-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3483517 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 5-butyl-2-methyl-1-(2-piperidin-1-ylethyl)-4-thiophen-3-ylpyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccsc2)c(C(N)=O)c(C)n1CCN1CCCCC1 |
| InChI | InChI=1S/C21H31N3OS/c1-3-4-8-18-20(17-9-14-26-15-17)19(21(22)25)16(2)24(18)13-12-23-10-6-5-7-11-23/h9,14-15H,3-8,10-13H2,1-2H3,(H2,22,25) |
| InChIKey | KONSNDIXQHCZJN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |