C20H27N3O2S — CID 3564068
2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-propyl-4-thiophen-3-ylpyrrole-3-carboxamide (PubChem CID 3564068) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-propyl-4-thiophen-3-ylpyrrole-3-carboxamide.
| Compound Name | 2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-propyl-4-thiophen-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3564068 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-propyl-4-thiophen-3-ylpyrrole-3-carboxamide |
| SMILES | CCCc1c(-c2ccsc2)c(C(N)=O)c(C)n1CCCN1CCCC1=O |
| InChI | InChI=1S/C20H27N3O2S/c1-3-6-16-19(15-8-12-26-13-15)18(20(21)25)14(2)23(16)11-5-10-22-9-4-7-17(22)24/h8,12-13H,3-7,9-11H2,1-2H3,(H2,21,25) |
| InChIKey | PDUIAGZWGKJTSU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |