C24H35N3O2 — CID 3828892
1-(3-ethoxypropyl)-2-methyl-5-propyl-4-(4-pyrrolidin-1-ylphenyl)pyrrole-3-carboxamide (PubChem CID 3828892) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-methyl-5-propyl-4-(4-pyrrolidin-1-ylphenyl)pyrrole-3-carboxamide.
| Compound Name | 1-(3-ethoxypropyl)-2-methyl-5-propyl-4-(4-pyrrolidin-1-ylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3828892 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-methyl-5-propyl-4-(4-pyrrolidin-1-ylphenyl)pyrrole-3-carboxamide |
| SMILES | CCCc1c(-c2ccc(N3CCCC3)cc2)c(C(N)=O)c(C)n1CCCOCC |
| InChI | InChI=1S/C24H35N3O2/c1-4-9-21-23(19-10-12-20(13-11-19)26-14-6-7-15-26)22(24(25)28)18(3)27(21)16-8-17-29-5-2/h10-13H,4-9,14-17H2,1-3H3,(H2,25,28) |
| InChIKey | AYLZXBRAWRZXKS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|