C25H37N3O — CID 3758557
2-methyl-4-(4-methylphenyl)-5-pentyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 3758557) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is 2-methyl-4-(4-methylphenyl)-5-pentyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 2-methyl-4-(4-methylphenyl)-5-pentyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3758557 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 2-methyl-4-(4-methylphenyl)-5-pentyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccc(C)cc2)c(C(N)=O)c(C)n1CCN1CCCCC1 |
| InChI | InChI=1S/C25H37N3O/c1-4-5-7-10-22-24(21-13-11-19(2)12-14-21)23(25(26)29)20(3)28(22)18-17-27-15-8-6-9-16-27/h11-14H,4-10,15-18H2,1-3H3,(H2,26,29) |
| InChIKey | SGUNMWOJOFXCDR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|