C21H30N2O2 — CID 3748137
1,5-dibutyl-4-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide (PubChem CID 3748137) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1,5-dibutyl-4-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 1,5-dibutyl-4-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3748137 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1,5-dibutyl-4-(4-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccc(OC)cc2)c(C(N)=O)c(C)n1CCCC |
| InChI | InChI=1S/C21H30N2O2/c1-5-7-9-18-20(16-10-12-17(25-4)13-11-16)19(21(22)24)15(3)23(18)14-8-6-2/h10-13H,5-9,14H2,1-4H3,(H2,22,24) |
| InChIKey | QTDCKSQOASWZTF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |