C18H22N2O2 — CID 3696850
5-ethyl-4-(4-methoxyphenyl)-2-methyl-1-prop-2-enylpyrrole-3-carboxamide (PubChem CID 3696850) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-ethyl-4-(4-methoxyphenyl)-2-methyl-1-prop-2-enylpyrrole-3-carboxamide.
| Compound Name | 5-ethyl-4-(4-methoxyphenyl)-2-methyl-1-prop-2-enylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3696850 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 5-ethyl-4-(4-methoxyphenyl)-2-methyl-1-prop-2-enylpyrrole-3-carboxamide |
| SMILES | C=CCn1c(C)c(C(N)=O)c(-c2ccc(OC)cc2)c1CC |
| InChI | InChI=1S/C18H22N2O2/c1-5-11-20-12(3)16(18(19)21)17(15(20)6-2)13-7-9-14(22-4)10-8-13/h5,7-10H,1,6,11H2,2-4H3,(H2,19,21) |
| InChIKey | RVBIAYVINYAQHQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|