C25H26N2O3 — CID 3853015
methyl 3-[4-carbamoyl-5-methyl-3-(4-phenylphenyl)-1-prop-2-enylpyrrol-2-yl]propanoate (PubChem CID 3853015) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl 3-[4-carbamoyl-5-methyl-3-(4-phenylphenyl)-1-prop-2-enylpyrrol-2-yl]propanoate.
| Compound Name | methyl 3-[4-carbamoyl-5-methyl-3-(4-phenylphenyl)-1-prop-2-enylpyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3853015 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | methyl 3-[4-carbamoyl-5-methyl-3-(4-phenylphenyl)-1-prop-2-enylpyrrol-2-yl]propanoate |
| SMILES | C=CCn1c(C)c(C(N)=O)c(-c2ccc(-c3ccccc3)cc2)c1CCC(=O)OC |
| InChI | InChI=1S/C25H26N2O3/c1-4-16-27-17(2)23(25(26)29)24(21(27)14-15-22(28)30-3)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h4-13H,1,14-16H2,2-3H3,(H2,26,29) |
| InChIKey | IZJSSGQGBBIZJP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|