C24H25BrN2O3 — CID 3711390
methyl 3-[3-(4-bromophenyl)-4-carbamoyl-5-methyl-1-(2-phenylethyl)pyrrol-2-yl]propanoate (PubChem CID 3711390) has the molecular formula C24H25BrN2O3 and a molecular weight of 469.38 g/mol. Its IUPAC name is methyl 3-[3-(4-bromophenyl)-4-carbamoyl-5-methyl-1-(2-phenylethyl)pyrrol-2-yl]propanoate.
| Compound Name | methyl 3-[3-(4-bromophenyl)-4-carbamoyl-5-methyl-1-(2-phenylethyl)pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3711390 |
| Molecular Formula | C24H25BrN2O3 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | methyl 3-[3-(4-bromophenyl)-4-carbamoyl-5-methyl-1-(2-phenylethyl)pyrrol-2-yl]propanoate |
| SMILES | COC(=O)CCc1c(-c2ccc(Br)cc2)c(C(N)=O)c(C)n1CCc1ccccc1 |
| InChI | InChI=1S/C24H25BrN2O3/c1-16-22(24(26)29)23(18-8-10-19(25)11-9-18)20(12-13-21(28)30-2)27(16)15-14-17-6-4-3-5-7-17/h3-11H,12-15H2,1-2H3,(H2,26,29) |
| InChIKey | APECLYQZQWDMQJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |