C25H28N2O4 — CID 3448433
methyl 3-[1-benzyl-4-carbamoyl-3-(4-methoxy-3-methylphenyl)-5-methylpyrrol-2-yl]propanoate (PubChem CID 3448433) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 3-[1-benzyl-4-carbamoyl-3-(4-methoxy-3-methylphenyl)-5-methylpyrrol-2-yl]propanoate.
| Compound Name | methyl 3-[1-benzyl-4-carbamoyl-3-(4-methoxy-3-methylphenyl)-5-methylpyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3448433 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | methyl 3-[1-benzyl-4-carbamoyl-3-(4-methoxy-3-methylphenyl)-5-methylpyrrol-2-yl]propanoate |
| SMILES | COC(=O)CCc1c(-c2ccc(OC)c(C)c2)c(C(N)=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O4/c1-16-14-19(10-12-21(16)30-3)24-20(11-13-22(28)31-4)27(17(2)23(24)25(26)29)15-18-8-6-5-7-9-18/h5-10,12,14H,11,13,15H2,1-4H3,(H2,26,29) |
| InChIKey | JKBMKOKTSSHCJQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |