C26H30N2O3 — CID 3740968
methyl 4-(1-benzyl-4-carbamoyl-5-methyl-2-pentylpyrrol-3-yl)benzoate (PubChem CID 3740968) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is methyl 4-(1-benzyl-4-carbamoyl-5-methyl-2-pentylpyrrol-3-yl)benzoate.
| Compound Name | methyl 4-(1-benzyl-4-carbamoyl-5-methyl-2-pentylpyrrol-3-yl)benzoate |
|---|---|
| PubChem CID | 3740968 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | methyl 4-(1-benzyl-4-carbamoyl-5-methyl-2-pentylpyrrol-3-yl)benzoate |
| SMILES | CCCCCc1c(-c2ccc(C(=O)OC)cc2)c(C(N)=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H30N2O3/c1-4-5-7-12-22-24(20-13-15-21(16-14-20)26(30)31-3)23(25(27)29)18(2)28(22)17-19-10-8-6-9-11-19/h6,8-11,13-16H,4-5,7,12,17H2,1-3H3,(H2,27,29) |
| InChIKey | HDZULACFBPNDSR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|