C24H25F3N2O2 — CID 3481918
1-benzyl-5-butyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide (PubChem CID 3481918) has the molecular formula C24H25F3N2O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-benzyl-5-butyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-benzyl-5-butyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3481918 |
| Molecular Formula | C24H25F3N2O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-benzyl-5-butyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2cccc(OC(F)(F)F)c2)c(C(N)=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H25F3N2O2/c1-3-4-13-20-22(18-11-8-12-19(14-18)31-24(25,26)27)21(23(28)30)16(2)29(20)15-17-9-6-5-7-10-17/h5-12,14H,3-4,13,15H2,1-2H3,(H2,28,30) |
| InChIKey | CYFSCFNDJRIJPC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |