C19H23F3N2O2 — CID 5100318
1-butyl-5-ethyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide (PubChem CID 5100318) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 1-butyl-5-ethyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-butyl-5-ethyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 5100318 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-butyl-5-ethyl-2-methyl-4-[3-(trifluoromethoxy)phenyl]pyrrole-3-carboxamide |
| SMILES | CCCCn1c(C)c(C(N)=O)c(-c2cccc(OC(F)(F)F)c2)c1CC |
| InChI | InChI=1S/C19H23F3N2O2/c1-4-6-10-24-12(3)16(18(23)25)17(15(24)5-2)13-8-7-9-14(11-13)26-19(20,21)22/h7-9,11H,4-6,10H2,1-3H3,(H2,23,25) |
| InChIKey | NXDWDRHTOFXFHP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |