C20H27FN2O — CID 3748139
1,5-dibutyl-4-(3-fluorophenyl)-2-methylpyrrole-3-carboxamide (PubChem CID 3748139) has the molecular formula C20H27FN2O and a molecular weight of 330.45 g/mol. Its IUPAC name is 1,5-dibutyl-4-(3-fluorophenyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 1,5-dibutyl-4-(3-fluorophenyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3748139 |
| Molecular Formula | C20H27FN2O |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1,5-dibutyl-4-(3-fluorophenyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2cccc(F)c2)c(C(N)=O)c(C)n1CCCC |
| InChI | InChI=1S/C20H27FN2O/c1-4-6-11-17-19(15-9-8-10-16(21)13-15)18(20(22)24)14(3)23(17)12-7-5-2/h8-10,13H,4-7,11-12H2,1-3H3,(H2,22,24) |
| InChIKey | DGSQRHUUWWSAQD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |