C22H27FN4O — CID 3691039
4-(3-fluorophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-5-pentylpyrrole-3-carboxamide (PubChem CID 3691039) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-5-pentylpyrrole-3-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-5-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3691039 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 4-(3-fluorophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-5-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2cccc(F)c2)c(C(N)=O)c(C)n1CCc1cnc[nH]1 |
| InChI | InChI=1S/C22H27FN4O/c1-3-4-5-9-19-21(16-7-6-8-17(23)12-16)20(22(24)28)15(2)27(19)11-10-18-13-25-14-26-18/h6-8,12-14H,3-5,9-11H2,1-2H3,(H2,24,28)(H,25,26) |
| InChIKey | FLJCOHQERUAIPQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|