C27H30N4O2 — CID 3849110
5-butyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide (PubChem CID 3849110) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 5-butyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide.
| Compound Name | 5-butyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3849110 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 5-butyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2cccc(Oc3ccccc3)c2)c(C(N)=O)c(C)n1CCc1cnc[nH]1 |
| InChI | InChI=1S/C27H30N4O2/c1-3-4-13-24-26(20-9-8-12-23(16-20)33-22-10-6-5-7-11-22)25(27(28)32)19(2)31(24)15-14-21-17-29-18-30-21/h5-12,16-18H,3-4,13-15H2,1-2H3,(H2,28,32)(H,29,30) |
| InChIKey | OXHCZIFFQAYGOM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |