C22H23N5O — CID 3776382
5-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-quinolin-2-ylpyrrole-3-carboxamide (PubChem CID 3776382) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 5-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-quinolin-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-quinolin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3776382 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 5-ethyl-1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-quinolin-2-ylpyrrole-3-carboxamide |
| SMILES | CCc1c(-c2ccc3ccccc3n2)c(C(N)=O)c(C)n1CCc1cnc[nH]1 |
| InChI | InChI=1S/C22H23N5O/c1-3-19-21(18-9-8-15-6-4-5-7-17(15)26-18)20(22(23)28)14(2)27(19)11-10-16-12-24-13-25-16/h4-9,12-13H,3,10-11H2,1-2H3,(H2,23,28)(H,24,25) |
| InChIKey | TWZDMDCEKVVCBK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |