C22H25N5O — CID 3741402
5-butyl-4-(4-cyanophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrrole-3-carboxamide (PubChem CID 3741402) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 5-butyl-4-(4-cyanophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrrole-3-carboxamide.
| Compound Name | 5-butyl-4-(4-cyanophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3741402 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 5-butyl-4-(4-cyanophenyl)-1-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccc(C#N)cc2)c(C(N)=O)c(C)n1CCc1cnc[nH]1 |
| InChI | InChI=1S/C22H25N5O/c1-3-4-5-19-21(17-8-6-16(12-23)7-9-17)20(22(24)28)15(2)27(19)11-10-18-13-25-14-26-18/h6-9,13-14H,3-5,10-11H2,1-2H3,(H2,24,28)(H,25,26) |
| InChIKey | FXAUOXDERNGMHY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |