C26H28N4O — CID 3830805
1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(4-phenylphenyl)-5-propylpyrrole-3-carboxamide (PubChem CID 3830805) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(4-phenylphenyl)-5-propylpyrrole-3-carboxamide.
| Compound Name | 1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(4-phenylphenyl)-5-propylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3830805 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-[2-(1H-imidazol-5-yl)ethyl]-2-methyl-4-(4-phenylphenyl)-5-propylpyrrole-3-carboxamide |
| SMILES | CCCc1c(-c2ccc(-c3ccccc3)cc2)c(C(N)=O)c(C)n1CCc1cnc[nH]1 |
| InChI | InChI=1S/C26H28N4O/c1-3-7-23-25(21-12-10-20(11-13-21)19-8-5-4-6-9-19)24(26(27)31)18(2)30(23)15-14-22-16-28-17-29-22/h4-6,8-13,16-17H,3,7,14-15H2,1-2H3,(H2,27,31)(H,28,29) |
| InChIKey | NUFKGNPWZKURDZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |