C26H32N4O2 — CID 4985747
5-butyl-2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-4-quinolin-2-ylpyrrole-3-carboxamide (PubChem CID 4985747) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 5-butyl-2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-4-quinolin-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-butyl-2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-4-quinolin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 4985747 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5-butyl-2-methyl-1-[3-(2-oxopyrrolidin-1-yl)propyl]-4-quinolin-2-ylpyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccc3ccccc3n2)c(C(N)=O)c(C)n1CCCN1CCCC1=O |
| InChI | InChI=1S/C26H32N4O2/c1-3-4-11-22-25(21-14-13-19-9-5-6-10-20(19)28-21)24(26(27)32)18(2)30(22)17-8-16-29-15-7-12-23(29)31/h5-6,9-10,13-14H,3-4,7-8,11-12,15-17H2,1-2H3,(H2,27,32) |
| InChIKey | GOEXJTIHGYWSIV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |