C30H32N2O3 — CID 3781030
5-butyl-1-[(2-methoxyphenyl)methyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide (PubChem CID 3781030) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 5-butyl-1-[(2-methoxyphenyl)methyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide.
| Compound Name | 5-butyl-1-[(2-methoxyphenyl)methyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3781030 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 5-butyl-1-[(2-methoxyphenyl)methyl]-2-methyl-4-(3-phenoxyphenyl)pyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2cccc(Oc3ccccc3)c2)c(C(N)=O)c(C)n1Cc1ccccc1OC |
| InChI | InChI=1S/C30H32N2O3/c1-4-5-17-26-29(22-13-11-16-25(19-22)35-24-14-7-6-8-15-24)28(30(31)33)21(2)32(26)20-23-12-9-10-18-27(23)34-3/h6-16,18-19H,4-5,17,20H2,1-3H3,(H2,31,33) |
| InChIKey | JFMZJTIVZMCCJP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |