C30H39N3O2 — CID 3814423
2-methyl-5-pentyl-4-(3-phenoxyphenyl)-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 3814423) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is 2-methyl-5-pentyl-4-(3-phenoxyphenyl)-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 2-methyl-5-pentyl-4-(3-phenoxyphenyl)-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3814423 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 2-methyl-5-pentyl-4-(3-phenoxyphenyl)-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2cccc(Oc3ccccc3)c2)c(C(N)=O)c(C)n1CCN1CCCCC1 |
| InChI | InChI=1S/C30H39N3O2/c1-3-4-7-17-27-29(24-13-12-16-26(22-24)35-25-14-8-5-9-15-25)28(30(31)34)23(2)33(27)21-20-32-18-10-6-11-19-32/h5,8-9,12-16,22H,3-4,6-7,10-11,17-21H2,1-2H3,(H2,31,34) |
| InChIKey | PUDNZVVINDYZBZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|