C27H34N2O2 — CID 3740985
4-(4-tert-butylphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-propylpyrrole-3-carboxamide (PubChem CID 3740985) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-propylpyrrole-3-carboxamide.
| Compound Name | 4-(4-tert-butylphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-propylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3740985 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1-[(2-methoxyphenyl)methyl]-2-methyl-5-propylpyrrole-3-carboxamide |
| SMILES | CCCc1c(-c2ccc(C(C)(C)C)cc2)c(C(N)=O)c(C)n1Cc1ccccc1OC |
| InChI | InChI=1S/C27H34N2O2/c1-7-10-22-25(19-13-15-21(16-14-19)27(3,4)5)24(26(28)30)18(2)29(22)17-20-11-8-9-12-23(20)31-6/h8-9,11-16H,7,10,17H2,1-6H3,(H2,28,30) |
| InChIKey | GYYUGQRGYYFPLA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |